About [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone
[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 114781295) has the molecular formula C11H15ClN2O2S
and a molecular weight of 274.77 g/mol. Its IUPAC name is [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone |
| PubChem CID | 114781295 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cscn2)CC(CCl)O1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-11(2)6-14(4-8(3-12)16-11)10(15)9-5-17-7-13-9/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | DRSGFMSSKFJYMY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone?
The IUPAC name of [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone (CID 114781295) is [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone?
The canonical SMILES for [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone is CC1(C)CN(C(=O)c2cscn2)CC(CCl)O1.
What is the InChIKey of [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone?
The InChIKey is DRSGFMSSKFJYMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O2S/c1-11(2)6-14(4-8(3-12)16-11)10(15)9-5-17-7-13-9/h5,7-8H,3-4,6H2,1-2H3.
What are the key properties of [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone?
[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone has a molecular weight of 274.77 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 114781295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).