C13H15BrN6S — CID 114785336
6-N-[(5-bromothiophen-2-yl)methyl]-2-N-propyl-7H-purine-2,6-diamine (PubChem CID 114785336) has the molecular formula C13H15BrN6S and a molecular weight of 367.28 g/mol. Its IUPAC name is 6-N-[(5-bromothiophen-2-yl)methyl]-2-N-propyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(5-bromothiophen-2-yl)methyl]-2-N-propyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785336 |
| Molecular Formula | C13H15BrN6S |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 6-N-[(5-bromothiophen-2-yl)methyl]-2-N-propyl-7H-purine-2,6-diamine |
| SMILES | CCCNc1nc(NCc2ccc(Br)s2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H15BrN6S/c1-2-5-15-13-19-11(10-12(20-13)18-7-17-10)16-6-8-3-4-9(14)21-8/h3-4,7H,2,5-6H2,1H3,(H3,15,16,17,18,19,20) |
| InChIKey | BQMJCPSOYXCEDJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |