C14H17N5 — CID 114787324
2-(5,6-dimethyl-1,2,4-triazin-3-yl)-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 114787324) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,2,4-triazin-3-yl)-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | 2-(5,6-dimethyl-1,2,4-triazin-3-yl)-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 114787324 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-(5,6-dimethyl-1,2,4-triazin-3-yl)-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | Cc1nnc(N2CCc3ccc(N)cc3C2)nc1C |
| InChI | InChI=1S/C14H17N5/c1-9-10(2)17-18-14(16-9)19-6-5-11-3-4-13(15)7-12(11)8-19/h3-4,7H,5-6,8,15H2,1-2H3 |
| InChIKey | SBQFBHSEPGOJLL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|