C17H16FN3 — CID 114789197
N-[(4-fluoro-3,5-dimethylphenyl)methyl]quinazolin-2-amine (PubChem CID 114789197) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[(4-fluoro-3,5-dimethylphenyl)methyl]quinazolin-2-amine.
| Compound Name | N-[(4-fluoro-3,5-dimethylphenyl)methyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 114789197 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[(4-fluoro-3,5-dimethylphenyl)methyl]quinazolin-2-amine |
| SMILES | Cc1cc(CNc2ncc3ccccc3n2)cc(C)c1F |
| InChI | InChI=1S/C17H16FN3/c1-11-7-13(8-12(2)16(11)18)9-19-17-20-10-14-5-3-4-6-15(14)21-17/h3-8,10H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | YYMAXKBJYVFQAQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |