C15H12N6 — CID 167884841
N-(2H-benzotriazol-5-ylmethyl)quinazolin-2-amine (PubChem CID 167884841) has the molecular formula C15H12N6 and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(2H-benzotriazol-5-ylmethyl)quinazolin-2-amine.
| Compound Name | N-(2H-benzotriazol-5-ylmethyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 167884841 |
| Molecular Formula | C15H12N6 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(2H-benzotriazol-5-ylmethyl)quinazolin-2-amine |
| SMILES | c1ccc2nc(NCc3ccc4n[nH]nc4c3)ncc2c1 |
| InChI | InChI=1S/C15H12N6/c1-2-4-12-11(3-1)9-17-15(18-12)16-8-10-5-6-13-14(7-10)20-21-19-13/h1-7,9H,8H2,(H,16,17,18)(H,19,20,21) |
| InChIKey | UXRWEHKYEKONQY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |