C15H17N3O2 — CID 114789710
methyl 1-quinazolin-2-ylpiperidine-2-carboxylate (PubChem CID 114789710) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl 1-quinazolin-2-ylpiperidine-2-carboxylate.
| Compound Name | methyl 1-quinazolin-2-ylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 114789710 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | methyl 1-quinazolin-2-ylpiperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1c1ncc2ccccc2n1 |
| InChI | InChI=1S/C15H17N3O2/c1-20-14(19)13-8-4-5-9-18(13)15-16-10-11-6-2-3-7-12(11)17-15/h2-3,6-7,10,13H,4-5,8-9H2,1H3 |
| InChIKey | SEXMTDDIYOCBFM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |