C16H24ClNO2S — CID 114792080
2-[(4-chlorophenyl)methylsulfonyl]-4-propylcyclohexan-1-amine (PubChem CID 114792080) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfonyl]-4-propylcyclohexan-1-amine.
| Compound Name | 2-[(4-chlorophenyl)methylsulfonyl]-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 114792080 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfonyl]-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(N)C(S(=O)(=O)Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H24ClNO2S/c1-2-3-12-6-9-15(18)16(10-12)21(19,20)11-13-4-7-14(17)8-5-13/h4-5,7-8,12,15-16H,2-3,6,9-11,18H2,1H3 |
| InChIKey | QIFQUWWCDXGKIE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |