C15H21Cl2N — CID 81014836
2-(2,5-dichlorophenyl)-4-propylcyclohexan-1-amine (PubChem CID 81014836) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-4-propylcyclohexan-1-amine.
| Compound Name | 2-(2,5-dichlorophenyl)-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81014836 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(N)C(c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C15H21Cl2N/c1-2-3-10-4-7-15(18)13(8-10)12-9-11(16)5-6-14(12)17/h5-6,9-10,13,15H,2-4,7-8,18H2,1H3 |
| InChIKey | VDFPIVJWZRXEPU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |