C17H25Cl2N — CID 81032114
N-[[2-(2,5-dichlorophenyl)-4-methylcyclohexyl]methyl]propan-1-amine (PubChem CID 81032114) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[[2-(2,5-dichlorophenyl)-4-methylcyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2,5-dichlorophenyl)-4-methylcyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81032114 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[[2-(2,5-dichlorophenyl)-4-methylcyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCC(C)CC1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H25Cl2N/c1-3-8-20-11-13-5-4-12(2)9-15(13)16-10-14(18)6-7-17(16)19/h6-7,10,12-13,15,20H,3-5,8-9,11H2,1-2H3 |
| InChIKey | ULCFRIISGAVKHS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|