C33H53BrO7 — CID 11479238
[(2R,4R,5S,15R,16S)-4-acetyloxy-15-[(2S,5S)-4-bromo-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate (PubChem CID 11479238) has the molecular formula C33H53BrO7 and a molecular weight of 641.68 g/mol. Its IUPAC name is [(2R,4R,5S,15R,16S)-4-acetyloxy-15-[(2S,5S)-4-bromo-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate.
| Compound Name | [(2R,4R,5S,15R,16S)-4-acetyloxy-15-[(2S,5S)-4-bromo-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 11479238 |
| Molecular Formula | C33H53BrO7 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | [(2R,4R,5S,15R,16S)-4-acetyloxy-15-[(2S,5S)-4-bromo-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-2,16-dimethyl-8-oxo-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate |
| SMILES | CC[C@@H](C(C)C)C(Br)C(O)[C@@H](C)[C@H]1CCC2C3COC(=O)C4C[C@H](OC(C)=O)[C@H](OC(C)=O)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H53BrO7/c1-9-21(17(2)3)29(34)30(37)18(4)23-10-11-24-22-16-39-31(38)26-14-27(40-19(5)35)28(41-20(6)36)15-33(26,8)25(22)12-13-32(23,24)7/h17-18,21-30,37H,9-16H2,1-8H3/t18-,21-,22?,23+,24?,25?,26?,27-,28+,29?,30?,32+,33+/m0/s1 |
| InChIKey | JELNELZDSKDRQN-NYAQFNTHSA-N |
| XLogP | 6.32 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|