C15H19F3O2 — CID 114794872
1-cyclohexyl-1-[2-(trifluoromethoxy)phenyl]ethanol (PubChem CID 114794872) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-cyclohexyl-1-[2-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 1-cyclohexyl-1-[2-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 114794872 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-cyclohexyl-1-[2-(trifluoromethoxy)phenyl]ethanol |
| SMILES | CC(O)(c1ccccc1OC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C15H19F3O2/c1-14(19,11-7-3-2-4-8-11)12-9-5-6-10-13(12)20-15(16,17)18/h5-6,9-11,19H,2-4,7-8H2,1H3 |
| InChIKey | WJEAPYVCJKZYCK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |