C8H21N3O2S — CID 114803911
3-(aminomethyl)-3-[methyl(methylsulfamoyl)amino]pentane (PubChem CID 114803911) has the molecular formula C8H21N3O2S and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-(aminomethyl)-3-[methyl(methylsulfamoyl)amino]pentane.
| Compound Name | 3-(aminomethyl)-3-[methyl(methylsulfamoyl)amino]pentane |
|---|---|
| PubChem CID | 114803911 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(aminomethyl)-3-[methyl(methylsulfamoyl)amino]pentane |
| SMILES | CCC(CC)(CN)N(C)S(=O)(=O)NC |
| InChI | InChI=1S/C8H21N3O2S/c1-5-8(6-2,7-9)11(4)14(12,13)10-3/h10H,5-7,9H2,1-4H3 |
| InChIKey | NFYVFNGFCGWLJD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |