C12H27N3O4S — CID 114461365
ethyl N-[3-(aminomethyl)pentan-3-yl-propylsulfamoyl]carbamate (PubChem CID 114461365) has the molecular formula C12H27N3O4S and a molecular weight of 309.43 g/mol. Its IUPAC name is ethyl N-[3-(aminomethyl)pentan-3-yl-propylsulfamoyl]carbamate.
| Compound Name | ethyl N-[3-(aminomethyl)pentan-3-yl-propylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461365 |
| Molecular Formula | C12H27N3O4S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl N-[3-(aminomethyl)pentan-3-yl-propylsulfamoyl]carbamate |
| SMILES | CCCN(C(CC)(CC)CN)S(=O)(=O)NC(=O)OCC |
| InChI | InChI=1S/C12H27N3O4S/c1-5-9-15(12(6-2,7-3)10-13)20(17,18)14-11(16)19-8-4/h5-10,13H2,1-4H3,(H,14,16) |
| InChIKey | ZMOFTPBUYTYQDT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |