C8H17N5O2S — CID 114804868
5-N-(tert-butylsulfamoyl)-1-methylpyrazole-4,5-diamine (PubChem CID 114804868) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-N-(tert-butylsulfamoyl)-1-methylpyrazole-4,5-diamine.
| Compound Name | 5-N-(tert-butylsulfamoyl)-1-methylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 114804868 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-N-(tert-butylsulfamoyl)-1-methylpyrazole-4,5-diamine |
| SMILES | Cn1ncc(N)c1NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C8H17N5O2S/c1-8(2,3)12-16(14,15)11-7-6(9)5-10-13(7)4/h5,11-12H,9H2,1-4H3 |
| InChIKey | QVOVHUWHSMAOJT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |