C7H13F3N2O2S — CID 114807258
(E)-N-(2,2,2-trifluoroethylsulfamoyl)pent-3-en-1-amine (PubChem CID 114807258) has the molecular formula C7H13F3N2O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is (E)-N-(2,2,2-trifluoroethylsulfamoyl)pent-3-en-1-amine.
| Compound Name | (E)-N-(2,2,2-trifluoroethylsulfamoyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 114807258 |
| Molecular Formula | C7H13F3N2O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (E)-N-(2,2,2-trifluoroethylsulfamoyl)pent-3-en-1-amine |
| SMILES | C/C=C/CCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O2S/c1-2-3-4-5-11-15(13,14)12-6-7(8,9)10/h2-3,11-12H,4-6H2,1H3/b3-2+ |
| InChIKey | NOCYEHPXFBXLQF-NSCUHMNNSA-N |
| XLogP | 0.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|