C4H8F3N3O2S2 — CID 114808100
2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide (PubChem CID 114808100) has the molecular formula C4H8F3N3O2S2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide.
| Compound Name | 2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide |
|---|---|
| PubChem CID | 114808100 |
| Molecular Formula | C4H8F3N3O2S2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide |
| SMILES | NC(=S)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C4H8F3N3O2S2/c5-4(6,7)2-10-14(11,12)9-1-3(8)13/h9-10H,1-2H2,(H2,8,13) |
| InChIKey | RCMKXXPAUXUWGY-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|