C6H12F3N3O2S2 — CID 114808244
2-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide (PubChem CID 114808244) has the molecular formula C6H12F3N3O2S2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide.
| Compound Name | 2-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 114808244 |
| Molecular Formula | C6H12F3N3O2S2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]ethanethioamide |
| SMILES | CCN(CC(N)=S)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H12F3N3O2S2/c1-2-12(3-5(10)15)16(13,14)11-4-6(7,8)9/h11H,2-4H2,1H3,(H2,10,15) |
| InChIKey | YWWFHDDVJVLOCJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|