C5H10F3N3O2S2 — CID 114808114
2-(2,2,2-trifluoroethylsulfamoylamino)propanethioamide (PubChem CID 114808114) has the molecular formula C5H10F3N3O2S2 and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)propanethioamide.
| Compound Name | 2-(2,2,2-trifluoroethylsulfamoylamino)propanethioamide |
|---|---|
| PubChem CID | 114808114 |
| Molecular Formula | C5H10F3N3O2S2 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfamoylamino)propanethioamide |
| SMILES | CC(NS(=O)(=O)NCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C5H10F3N3O2S2/c1-3(4(9)14)11-15(12,13)10-2-5(6,7)8/h3,10-11H,2H2,1H3,(H2,9,14) |
| InChIKey | YVKYZMIWCQNGNA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|