C9H17N3O2S2 — CID 114808140
1-(cyclopropylsulfamoylamino)cyclopentane-1-carbothioamide (PubChem CID 114808140) has the molecular formula C9H17N3O2S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-(cyclopropylsulfamoylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(cyclopropylsulfamoylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 114808140 |
| Molecular Formula | C9H17N3O2S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1-(cyclopropylsulfamoylamino)cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)NC2CC2)CCCC1 |
| InChI | InChI=1S/C9H17N3O2S2/c10-8(15)9(5-1-2-6-9)12-16(13,14)11-7-3-4-7/h7,11-12H,1-6H2,(H2,10,15) |
| InChIKey | RXJJFHCYBAGLLS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|