C11H20F3N3O2S2 — CID 114808153
4-ethyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide (PubChem CID 114808153) has the molecular formula C11H20F3N3O2S2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 4-ethyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide.
| Compound Name | 4-ethyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 114808153 |
| Molecular Formula | C11H20F3N3O2S2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-ethyl-1-(2,2,2-trifluoroethylsulfamoylamino)cyclohexane-1-carbothioamide |
| SMILES | CCC1CCC(NS(=O)(=O)NCC(F)(F)F)(C(N)=S)CC1 |
| InChI | InChI=1S/C11H20F3N3O2S2/c1-2-8-3-5-10(6-4-8,9(15)20)17-21(18,19)16-7-11(12,13)14/h8,16-17H,2-7H2,1H3,(H2,15,20) |
| InChIKey | ZAULGTWLICJNAL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|