C10H18F3N3O2S2 — CID 114808182
2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide (PubChem CID 114808182) has the molecular formula C10H18F3N3O2S2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide.
| Compound Name | 2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide |
|---|---|
| PubChem CID | 114808182 |
| Molecular Formula | C10H18F3N3O2S2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)ethanethioamide |
| SMILES | NC(=S)C(NS(=O)(=O)NCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H18F3N3O2S2/c11-10(12,13)6-15-20(17,18)16-8(9(14)19)7-4-2-1-3-5-7/h7-8,15-16H,1-6H2,(H2,14,19) |
| InChIKey | OQBLHSUQHIATDY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|