C8H19N3O2S2 — CID 114808165
2-methyl-2-(propylsulfamoylamino)butanethioamide (PubChem CID 114808165) has the molecular formula C8H19N3O2S2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methyl-2-(propylsulfamoylamino)butanethioamide.
| Compound Name | 2-methyl-2-(propylsulfamoylamino)butanethioamide |
|---|---|
| PubChem CID | 114808165 |
| Molecular Formula | C8H19N3O2S2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-methyl-2-(propylsulfamoylamino)butanethioamide |
| SMILES | CCCNS(=O)(=O)NC(C)(CC)C(N)=S |
| InChI | InChI=1S/C8H19N3O2S2/c1-4-6-10-15(12,13)11-8(3,5-2)7(9)14/h10-11H,4-6H2,1-3H3,(H2,9,14) |
| InChIKey | QBVJNKDOJZZDJQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|