C8H16F3N3O2S2 — CID 114808199
3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-2-methylpropanethioamide (PubChem CID 114808199) has the molecular formula C8H16F3N3O2S2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-2-methylpropanethioamide.
| Compound Name | 3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 114808199 |
| Molecular Formula | C8H16F3N3O2S2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O2S2/c1-3-14(4-6(2)7(12)17)18(15,16)13-5-8(9,10)11/h6,13H,3-5H2,1-2H3,(H2,12,17) |
| InChIKey | JGEVSCBRYDSXDN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|