C7H14F3N3O2S2 — CID 114808212
2-methyl-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide (PubChem CID 114808212) has the molecular formula C7H14F3N3O2S2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-methyl-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide.
| Compound Name | 2-methyl-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide |
|---|---|
| PubChem CID | 114808212 |
| Molecular Formula | C7H14F3N3O2S2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-methyl-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide |
| SMILES | CC(CN(C)S(=O)(=O)NCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C7H14F3N3O2S2/c1-5(6(11)16)3-13(2)17(14,15)12-4-7(8,9)10/h5,12H,3-4H2,1-2H3,(H2,11,16) |
| InChIKey | PIEGPYATAMKPNV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|