C9H18F3N3O2S2 — CID 114808231
3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide (PubChem CID 114808231) has the molecular formula C9H18F3N3O2S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide.
| Compound Name | 3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide |
|---|---|
| PubChem CID | 114808231 |
| Molecular Formula | C9H18F3N3O2S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanethioamide |
| SMILES | CC(C)CN(CCC(N)=S)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O2S2/c1-7(2)5-15(4-3-8(13)18)19(16,17)14-6-9(10,11)12/h7,14H,3-6H2,1-2H3,(H2,13,18) |
| InChIKey | UDAAFXDXZGETKE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|