C5H12N6O2S — CID 114810044
N-(2H-tetrazol-5-ylmethylsulfamoyl)propan-2-amine (PubChem CID 114810044) has the molecular formula C5H12N6O2S and a molecular weight of 220.26 g/mol. Its IUPAC name is N-(2H-tetrazol-5-ylmethylsulfamoyl)propan-2-amine.
| Compound Name | N-(2H-tetrazol-5-ylmethylsulfamoyl)propan-2-amine |
|---|---|
| PubChem CID | 114810044 |
| Molecular Formula | C5H12N6O2S |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-(2H-tetrazol-5-ylmethylsulfamoyl)propan-2-amine |
| SMILES | CC(C)NS(=O)(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C5H12N6O2S/c1-4(2)9-14(12,13)6-3-5-7-10-11-8-5/h4,6,9H,3H2,1-2H3,(H,7,8,10,11) |
| InChIKey | NKONSAVEXNNMCT-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |