C6H14F3N3O2S — CID 114810646
N-ethyl-N'-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine (PubChem CID 114810646) has the molecular formula C6H14F3N3O2S and a molecular weight of 249.26 g/mol. Its IUPAC name is N-ethyl-N'-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114810646 |
| Molecular Formula | C6H14F3N3O2S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-ethyl-N'-(2,2,2-trifluoroethylsulfamoyl)ethane-1,2-diamine |
| SMILES | CCNCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H14F3N3O2S/c1-2-10-3-4-11-15(13,14)12-5-6(7,8)9/h10-12H,2-5H2,1H3 |
| InChIKey | VCYSAYKJMUBKJA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|