C8H16F3N3O2S — CID 114810916
2,2-dimethyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 114810916) has the molecular formula C8H16F3N3O2S and a molecular weight of 275.30 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
| Compound Name | 2,2-dimethyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 114810916 |
| Molecular Formula | C8H16F3N3O2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2,2-dimethyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | CC1(C)CNCCN1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O2S/c1-7(2)5-12-3-4-14(7)17(15,16)13-6-8(9,10)11/h12-13H,3-6H2,1-2H3 |
| InChIKey | AAICZHTZAWQOHV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |