C10H13N3O3S2 — CID 114811712
4-[2-(cyclopropylsulfamoylamino)-1,3-thiazol-5-yl]but-3-yn-1-ol (PubChem CID 114811712) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-[2-(cyclopropylsulfamoylamino)-1,3-thiazol-5-yl]but-3-yn-1-ol.
| Compound Name | 4-[2-(cyclopropylsulfamoylamino)-1,3-thiazol-5-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 114811712 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-[2-(cyclopropylsulfamoylamino)-1,3-thiazol-5-yl]but-3-yn-1-ol |
| SMILES | O=S(=O)(Nc1ncc(C#CCCO)s1)NC1CC1 |
| InChI | InChI=1S/C10H13N3O3S2/c14-6-2-1-3-9-7-11-10(17-9)13-18(15,16)12-8-4-5-8/h7-8,12,14H,2,4-6H2,(H,11,13) |
| InChIKey | KJIIBXLCEJROMG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|