C14H14N2O3S2 — CID 60815253
N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-1-phenylmethanesulfonamide (PubChem CID 60815253) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 60815253 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C14H14N2O3S2/c17-9-5-4-8-13-10-15-14(20-13)16-21(18,19)11-12-6-2-1-3-7-12/h1-3,6-7,10,17H,5,9,11H2,(H,15,16) |
| InChIKey | QCUWTBCGIAKHAM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|