C11H14F3N3O2S2 — CID 114812155
2-(3-aminoprop-1-ynyl)-4-[[methyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]thiophene (PubChem CID 114812155) has the molecular formula C11H14F3N3O2S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-4-[[methyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]thiophene.
| Compound Name | 2-(3-aminoprop-1-ynyl)-4-[[methyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]thiophene |
|---|---|
| PubChem CID | 114812155 |
| Molecular Formula | C11H14F3N3O2S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-4-[[methyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]thiophene |
| SMILES | CN(Cc1csc(C#CCN)c1)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O2S2/c1-17(21(18,19)16-8-11(12,13)14)6-9-5-10(20-7-9)3-2-4-15/h5,7,16H,4,6,8,15H2,1H3 |
| InChIKey | BTWZOHPERLJIJS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|