C12H19N3O2S2 — CID 114812159
2-(3-aminoprop-1-ynyl)-4-[[methyl(propylsulfamoyl)amino]methyl]thiophene (PubChem CID 114812159) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-4-[[methyl(propylsulfamoyl)amino]methyl]thiophene.
| Compound Name | 2-(3-aminoprop-1-ynyl)-4-[[methyl(propylsulfamoyl)amino]methyl]thiophene |
|---|---|
| PubChem CID | 114812159 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-4-[[methyl(propylsulfamoyl)amino]methyl]thiophene |
| SMILES | CCCNS(=O)(=O)N(C)Cc1csc(C#CCN)c1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-3-7-14-19(16,17)15(2)9-11-8-12(18-10-11)5-4-6-13/h8,10,14H,3,6-7,9,13H2,1-2H3 |
| InChIKey | HCMUPGKLJOSPOI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|