C9H13N3O2S2 — CID 114959539
2-(3-aminoprop-1-ynyl)-4-[[methyl(sulfamoyl)amino]methyl]thiophene (PubChem CID 114959539) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-4-[[methyl(sulfamoyl)amino]methyl]thiophene.
| Compound Name | 2-(3-aminoprop-1-ynyl)-4-[[methyl(sulfamoyl)amino]methyl]thiophene |
|---|---|
| PubChem CID | 114959539 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-4-[[methyl(sulfamoyl)amino]methyl]thiophene |
| SMILES | CN(Cc1csc(C#CCN)c1)S(N)(=O)=O |
| InChI | InChI=1S/C9H13N3O2S2/c1-12(16(11,13)14)6-8-5-9(15-7-8)3-2-4-10/h5,7H,4,6,10H2,1H3,(H2,11,13,14) |
| InChIKey | YWJXHTFGVCVMIE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|