C10H16N4O4S — CID 114812273
2-[4-(ethylsulfamoylamino)phenoxy]-N'-hydroxyethanimidamide (PubChem CID 114812273) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-[4-(ethylsulfamoylamino)phenoxy]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(ethylsulfamoylamino)phenoxy]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 114812273 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[4-(ethylsulfamoylamino)phenoxy]-N'-hydroxyethanimidamide |
| SMILES | CCNS(=O)(=O)Nc1ccc(OC/C(N)=N/O)cc1 |
| InChI | InChI=1S/C10H16N4O4S/c1-2-12-19(16,17)14-8-3-5-9(6-4-8)18-7-10(11)13-15/h3-6,12,14-15H,2,7H2,1H3,(H2,11,13) |
| InChIKey | CHXKENIYDHVMCA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|