C9H19F3N4O2S — CID 114813480
3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide (PubChem CID 114813480) has the molecular formula C9H19F3N4O2S and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide.
| Compound Name | 3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114813480 |
| Molecular Formula | C9H19F3N4O2S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CC(C)C)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N4O2S/c1-7(2)5-16(4-3-8(13)14)19(17,18)15-6-9(10,11)12/h7,15H,3-6H2,1-2H3,(H3,13,14) |
| InChIKey | COQALEWZTHAKJB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|