C13H27N3O2S2 — CID 114815218
4-ethyl-1-(2-methylpropylsulfamoylamino)cyclohexane-1-carbothioamide (PubChem CID 114815218) has the molecular formula C13H27N3O2S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 4-ethyl-1-(2-methylpropylsulfamoylamino)cyclohexane-1-carbothioamide.
| Compound Name | 4-ethyl-1-(2-methylpropylsulfamoylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 114815218 |
| Molecular Formula | C13H27N3O2S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-ethyl-1-(2-methylpropylsulfamoylamino)cyclohexane-1-carbothioamide |
| SMILES | CCC1CCC(NS(=O)(=O)NCC(C)C)(C(N)=S)CC1 |
| InChI | InChI=1S/C13H27N3O2S2/c1-4-11-5-7-13(8-6-11,12(14)19)16-20(17,18)15-9-10(2)3/h10-11,15-16H,4-9H2,1-3H3,(H2,14,19) |
| InChIKey | GXWWYRVMALXLDX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|