C13H26N2O3S2 — CID 63245615
1-(2-ethoxyethylsulfonylamino)-4-ethylcyclohexane-1-carbothioamide (PubChem CID 63245615) has the molecular formula C13H26N2O3S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-(2-ethoxyethylsulfonylamino)-4-ethylcyclohexane-1-carbothioamide.
| Compound Name | 1-(2-ethoxyethylsulfonylamino)-4-ethylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 63245615 |
| Molecular Formula | C13H26N2O3S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(2-ethoxyethylsulfonylamino)-4-ethylcyclohexane-1-carbothioamide |
| SMILES | CCOCCS(=O)(=O)NC1(C(N)=S)CCC(CC)CC1 |
| InChI | InChI=1S/C13H26N2O3S2/c1-3-11-5-7-13(8-6-11,12(14)19)15-20(16,17)10-9-18-4-2/h11,15H,3-10H2,1-2H3,(H2,14,19) |
| InChIKey | SGJDMFVGJDNNRP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|