C10H23N3O3S — CID 114816110
5-(aminomethyl)-N-(2-methoxyethyl)-2-methylpiperidine-1-sulfonamide (PubChem CID 114816110) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methoxyethyl)-2-methylpiperidine-1-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-methoxyethyl)-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114816110 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methoxyethyl)-2-methylpiperidine-1-sulfonamide |
| SMILES | COCCNS(=O)(=O)N1CC(CN)CCC1C |
| InChI | InChI=1S/C10H23N3O3S/c1-9-3-4-10(7-11)8-13(9)17(14,15)12-5-6-16-2/h9-10,12H,3-8,11H2,1-2H3 |
| InChIKey | LSMBHPARCFLXLD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|