C16H26O — CID 11481728
1-[(3S,4R)-3,4-dimethyl-2,4,5,6,7,8,9,10-octahydro-1H-benzo[8]annulen-3-yl]ethanone (PubChem CID 11481728) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-[(3S,4R)-3,4-dimethyl-2,4,5,6,7,8,9,10-octahydro-1H-benzo[8]annulen-3-yl]ethanone.
| Compound Name | 1-[(3S,4R)-3,4-dimethyl-2,4,5,6,7,8,9,10-octahydro-1H-benzo[8]annulen-3-yl]ethanone |
|---|---|
| PubChem CID | 11481728 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-[(3S,4R)-3,4-dimethyl-2,4,5,6,7,8,9,10-octahydro-1H-benzo[8]annulen-3-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CCC2=C(CCCCCC2)[C@H]1C |
| InChI | InChI=1S/C16H26O/c1-12-15-9-7-5-4-6-8-14(15)10-11-16(12,3)13(2)17/h12H,4-11H2,1-3H3/t12-,16+/m1/s1 |
| InChIKey | SUMUFZBATMSUNA-WBMJQRKESA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|