C16H26O — CID 20659558
1-(2,3,4-trimethyl-1,2,4,5,6,7,8,9-octahydrobenzo[7]annulen-3-yl)ethanone (PubChem CID 20659558) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-(2,3,4-trimethyl-1,2,4,5,6,7,8,9-octahydrobenzo[7]annulen-3-yl)ethanone.
| Compound Name | 1-(2,3,4-trimethyl-1,2,4,5,6,7,8,9-octahydrobenzo[7]annulen-3-yl)ethanone |
|---|---|
| PubChem CID | 20659558 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-(2,3,4-trimethyl-1,2,4,5,6,7,8,9-octahydrobenzo[7]annulen-3-yl)ethanone |
| SMILES | CC(=O)C1(C)C(C)CC2=C(CCCCC2)C1C |
| InChI | InChI=1S/C16H26O/c1-11-10-14-8-6-5-7-9-15(14)12(2)16(11,4)13(3)17/h11-12H,5-10H2,1-4H3 |
| InChIKey | QDIXGUFKYRBGFW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|