C12H20O2 — CID 121011477
4-acetyl-2,3,4,5-tetramethylcyclohexan-1-one (PubChem CID 121011477) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-acetyl-2,3,4,5-tetramethylcyclohexan-1-one.
| Compound Name | 4-acetyl-2,3,4,5-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 121011477 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 4-acetyl-2,3,4,5-tetramethylcyclohexan-1-one |
| SMILES | CC(=O)C1(C)C(C)CC(=O)C(C)C1C |
| InChI | InChI=1S/C12H20O2/c1-7-6-11(14)8(2)9(3)12(7,5)10(4)13/h7-9H,6H2,1-5H3 |
| InChIKey | HYOCORVJLWFSTA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |