C9H14O2S — CID 101181077
(1R)-1-methyl-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide (PubChem CID 101181077) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is (1R)-1-methyl-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide.
| Compound Name | (1R)-1-methyl-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide |
|---|---|
| PubChem CID | 101181077 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1R)-1-methyl-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide |
| SMILES | C[C@H]1OS(=O)CC2=C1CCCC2 |
| InChI | InChI=1S/C9H14O2S/c1-7-9-5-3-2-4-8(9)6-12(10)11-7/h7H,2-6H2,1H3/t7-,12?/m1/s1 |
| InChIKey | PKNHHESYKIQPRE-OJYJAAIMSA-N |
| XLogP | 1.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|