C8H11FO2S — CID 101170296
(1R)-1-fluoro-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide (PubChem CID 101170296) has the molecular formula C8H11FO2S and a molecular weight of 190.24 g/mol. Its IUPAC name is (1R)-1-fluoro-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide.
| Compound Name | (1R)-1-fluoro-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide |
|---|---|
| PubChem CID | 101170296 |
| Molecular Formula | C8H11FO2S |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (1R)-1-fluoro-1,4,5,6,7,8-hexahydro-2,3λ4-benzoxathiine 3-oxide |
| SMILES | O=S1CC2=C(CCCC2)[C@@H](F)O1 |
| InChI | InChI=1S/C8H11FO2S/c9-8-7-4-2-1-3-6(7)5-12(10)11-8/h8H,1-5H2/t8-,12?/m0/s1 |
| InChIKey | JNIOTLXIESMQLB-KBPLZSHQSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|