C10H16O2S — CID 101180943
1,4,5,6,7,8,9,10-octahydrocycloocta[d]oxathiine 3-oxide (PubChem CID 101180943) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 1,4,5,6,7,8,9,10-octahydrocycloocta[d]oxathiine 3-oxide.
| Compound Name | 1,4,5,6,7,8,9,10-octahydrocycloocta[d]oxathiine 3-oxide |
|---|---|
| PubChem CID | 101180943 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1,4,5,6,7,8,9,10-octahydrocycloocta[d]oxathiine 3-oxide |
| SMILES | O=S1CC2=C(CCCCCC2)CO1 |
| InChI | InChI=1S/C10H16O2S/c11-13-8-10-6-4-2-1-3-5-9(10)7-12-13/h1-8H2 |
| InChIKey | YMERZBNZBDRQEI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|