C24H39BSi — CID 91568568
borinan-1-yl-bis[(1S)-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-methylsilane (PubChem CID 91568568) has the molecular formula C24H39BSi and a molecular weight of 366.47 g/mol. Its IUPAC name is borinan-1-yl-bis[(1S)-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-methylsilane.
| Compound Name | borinan-1-yl-bis[(1S)-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-methylsilane |
|---|---|
| PubChem CID | 91568568 |
| Molecular Formula | C24H39BSi |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | borinan-1-yl-bis[(1S)-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-methylsilane |
| SMILES | C[Si](B1CCCCC1)([C@H]1CCC2=C1CCCC2)[C@H]1CCC2=C1CCCC2 |
| InChI | InChI=1S/C24H39BSi/c1-26(25-17-7-2-8-18-25,23-15-13-19-9-3-5-11-21(19)23)24-16-14-20-10-4-6-12-22(20)24/h23-24H,2-18H2,1H3/t23-,24-/m0/s1 |
| InChIKey | RHBXQWREZYPIFL-ZEQRLZLVSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|