C21H38N2 — CID 132988382
N-cyclohexyl-N'-(2-cyclohexylidenecyclohexyl)propane-1,3-diamine (PubChem CID 132988382) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N-cyclohexyl-N'-(2-cyclohexylidenecyclohexyl)propane-1,3-diamine.
| Compound Name | N-cyclohexyl-N'-(2-cyclohexylidenecyclohexyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 132988382 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N-cyclohexyl-N'-(2-cyclohexylidenecyclohexyl)propane-1,3-diamine |
| SMILES | C1CCC(=C2CCCCC2NCCCNC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H38N2/c1-3-10-18(11-4-1)20-14-7-8-15-21(20)23-17-9-16-22-19-12-5-2-6-13-19/h19,21-23H,1-17H2 |
| InChIKey | NIWOIGCKRQIPRE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|