C14H20O5 — CID 11482559
[(1R,4aS,6R)-1-but-3-enoxy-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-yl] methyl carbonate (PubChem CID 11482559) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is [(1R,4aS,6R)-1-but-3-enoxy-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-yl] methyl carbonate.
| Compound Name | [(1R,4aS,6R)-1-but-3-enoxy-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-yl] methyl carbonate |
|---|---|
| PubChem CID | 11482559 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [(1R,4aS,6R)-1-but-3-enoxy-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-yl] methyl carbonate |
| SMILES | C=CCCO[C@@H]1OCC[C@H]2C[C@@H](OC(=O)OC)C=C21 |
| InChI | InChI=1S/C14H20O5/c1-3-4-6-17-13-12-9-11(19-14(15)16-2)8-10(12)5-7-18-13/h3,9-11,13H,1,4-8H2,2H3/t10-,11+,13+/m0/s1 |
| InChIKey | NFBHGCFMXYWULP-DMDPSCGWSA-N |
| XLogP | 2.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|