C12H15N5O3 — CID 11482796
[(2E)-2-[(2-amino-6-methoxypurin-9-yl)methylidene]-1-(hydroxymethyl)cyclopropyl]methanol (PubChem CID 11482796) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(2E)-2-[(2-amino-6-methoxypurin-9-yl)methylidene]-1-(hydroxymethyl)cyclopropyl]methanol.
| Compound Name | [(2E)-2-[(2-amino-6-methoxypurin-9-yl)methylidene]-1-(hydroxymethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 11482796 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [(2E)-2-[(2-amino-6-methoxypurin-9-yl)methylidene]-1-(hydroxymethyl)cyclopropyl]methanol |
| SMILES | COc1nc(N)nc2c1ncn2/C=C1\CC1(CO)CO |
| InChI | InChI=1S/C12H15N5O3/c1-20-10-8-9(15-11(13)16-10)17(6-14-8)3-7-2-12(7,4-18)5-19/h3,6,18-19H,2,4-5H2,1H3,(H2,13,15,16)/b7-3+ |
| InChIKey | SIPMZEDNTNWSPI-XVNBXDOJSA-N |
| XLogP | -0.37 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |