C15H21N5O2 — CID 3006044
[(1S,2Z)-2-[(2-amino-6-pentoxypurin-9-yl)methylidene]cyclopropyl]methanol (PubChem CID 3006044) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is [(1S,2Z)-2-[(2-amino-6-pentoxypurin-9-yl)methylidene]cyclopropyl]methanol.
| Compound Name | [(1S,2Z)-2-[(2-amino-6-pentoxypurin-9-yl)methylidene]cyclopropyl]methanol |
|---|---|
| PubChem CID | 3006044 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | [(1S,2Z)-2-[(2-amino-6-pentoxypurin-9-yl)methylidene]cyclopropyl]methanol |
| SMILES | CCCCCOc1nc(N)nc2c1ncn2/C=C1/C[C@@H]1CO |
| InChI | InChI=1S/C15H21N5O2/c1-2-3-4-5-22-14-12-13(18-15(16)19-14)20(9-17-12)7-10-6-11(10)8-21/h7,9,11,21H,2-6,8H2,1H3,(H2,16,18,19)/b10-7-/t11-/m1/s1 |
| InChIKey | AVLGCEYSHLVFTJ-ZJRUKIMVSA-N |
| XLogP | 1.83 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|