C17H26O3 — CID 11482846
methyl (1R,4S,6R)-6-hydroxy-4-propan-2-yl-1,6-bis(prop-2-enyl)cyclohex-2-ene-1-carboxylate (PubChem CID 11482846) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl (1R,4S,6R)-6-hydroxy-4-propan-2-yl-1,6-bis(prop-2-enyl)cyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1R,4S,6R)-6-hydroxy-4-propan-2-yl-1,6-bis(prop-2-enyl)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11482846 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl (1R,4S,6R)-6-hydroxy-4-propan-2-yl-1,6-bis(prop-2-enyl)cyclohex-2-ene-1-carboxylate |
| SMILES | C=CC[C@@]1(O)C[C@@H](C(C)C)C=C[C@@]1(CC=C)C(=O)OC |
| InChI | InChI=1S/C17H26O3/c1-6-9-16(15(18)20-5)11-8-14(13(3)4)12-17(16,19)10-7-2/h6-8,11,13-14,19H,1-2,9-10,12H2,3-5H3/t14-,16-,17+/m0/s1 |
| InChIKey | XVRZYZFMDYUDMZ-BHYGNILZSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|